C39H34N4 — CID 139525782
4-[4-(5-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-8,9-dihydro-1H-pyrrolo[3,2-h]quinoline (PubChem CID 139525782) has the molecular formula C39H34N4 and a molecular weight of 558.73 g/mol. Its IUPAC name is 4-[4-(5-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-8,9-dihydro-1H-pyrrolo[3,2-h]quinoline.
| Compound Name | 4-[4-(5-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-8,9-dihydro-1H-pyrrolo[3,2-h]quinoline |
|---|---|
| PubChem CID | 139525782 |
| Molecular Formula | C39H34N4 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 4-[4-(5-cyclohexa-1,5-dien-1-yl-4,6-diphenyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-8,9-dihydro-1H-pyrrolo[3,2-h]quinoline |
| SMILES | C1=CC(C2=C(c3ccccc3)NC(c3ccc(-c4cc5c(c6[nH]ccc46)NCC=C5)cc3)NC2c2ccccc2)=CCC1 |
| InChI | InChI=1S/C39H34N4/c1-4-11-27(12-5-1)34-35(28-13-6-2-7-14-28)42-39(43-36(34)29-15-8-3-9-16-29)30-20-18-26(19-21-30)33-25-31-17-10-23-40-37(31)38-32(33)22-24-41-38/h2-4,6-22,24-25,35,39-43H,1,5,23H2 |
| InChIKey | KSLJMTFWHAGTQY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 51.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |