C28H36F2N2O6S — CID 139528913
1-[4-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]-4-[(2R)-2,3-dihydroxypropoxy]piperidin-1-yl]ethanone (PubChem CID 139528913) has the molecular formula C28H36F2N2O6S and a molecular weight of 566.67 g/mol. Its IUPAC name is 1-[4-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]-4-[(2R)-2,3-dihydroxypropoxy]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]-4-[(2R)-2,3-dihydroxypropoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 139528913 |
| Molecular Formula | C28H36F2N2O6S |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 1-[4-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]-4-[(2R)-2,3-dihydroxypropoxy]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(OC[C@H](O)CO)(c2cc(F)c(CC3[C@H](C)NC[C@@H](c4ccccc4)S3(=O)=O)cc2F)CC1 |
| InChI | InChI=1S/C28H36F2N2O6S/c1-18-26(39(36,37)27(15-31-18)20-6-4-3-5-7-20)13-21-12-25(30)23(14-24(21)29)28(38-17-22(35)16-33)8-10-32(11-9-28)19(2)34/h3-7,12,14,18,22,26-27,31,33,35H,8-11,13,15-17H2,1-2H3/t18-,22+,26?,27-/m0/s1 |
| InChIKey | HXVPNLVVLFABBM-QXTAZDFYSA-N |
| XLogP | 2.23 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |