C24H27F2NO5S — CID 118222930
(3S,4R)-3-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]oxane-4-carboxylic acid (PubChem CID 118222930) has the molecular formula C24H27F2NO5S and a molecular weight of 479.55 g/mol. Its IUPAC name is (3S,4R)-3-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]oxane-4-carboxylic acid.
| Compound Name | (3S,4R)-3-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 118222930 |
| Molecular Formula | C24H27F2NO5S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (3S,4R)-3-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1,4-thiazinan-2-yl]methyl]phenyl]oxane-4-carboxylic acid |
| SMILES | C[C@@H]1NC[C@@H](c2ccccc2)S(=O)(=O)C1Cc1cc(F)c([C@H]2COCC[C@H]2C(=O)O)cc1F |
| InChI | InChI=1S/C24H27F2NO5S/c1-14-22(33(30,31)23(12-27-14)15-5-3-2-4-6-15)10-16-9-21(26)18(11-20(16)25)19-13-32-8-7-17(19)24(28)29/h2-6,9,11,14,17,19,22-23,27H,7-8,10,12-13H2,1H3,(H,28,29)/t14-,17+,19-,22?,23-/m0/s1 |
| InChIKey | PGSXUNDFNTUMEO-DLIGDPRWSA-N |
| XLogP | 3.23 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |