C26H31F2N5O2S — CID 118223013
(3S,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-ethyl-6-phenyl-1,4-thiazinane 1,1-dioxide (PubChem CID 118223013) has the molecular formula C26H31F2N5O2S and a molecular weight of 515.63 g/mol. Its IUPAC name is (3S,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-ethyl-6-phenyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | (3S,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-ethyl-6-phenyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 118223013 |
| Molecular Formula | C26H31F2N5O2S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (3S,6R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-3-ethyl-6-phenyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC[C@@H]1NC[C@@H](c2ccccc2)S(=O)(=O)C1Cc1cc(F)c(N2CCC(n3cnnc3)CC2)cc1F |
| InChI | InChI=1S/C26H31F2N5O2S/c1-2-23-25(36(34,35)26(15-29-23)18-6-4-3-5-7-18)13-19-12-22(28)24(14-21(19)27)32-10-8-20(9-11-32)33-16-30-31-17-33/h3-7,12,14,16-17,20,23,25-26,29H,2,8-11,13,15H2,1H3/t23-,25?,26-/m0/s1 |
| InChIKey | CBWHELXGYMTPDU-RRLIAEKXSA-N |
| XLogP | 3.85 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |