C25H31F2N5O2S — CID 123478734
N-[1-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperidin-4-yl]-N-methanimidoylmethanimidamide (PubChem CID 123478734) has the molecular formula C25H31F2N5O2S and a molecular weight of 503.62 g/mol. Its IUPAC name is N-[1-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperidin-4-yl]-N-methanimidoylmethanimidamide.
| Compound Name | N-[1-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperidin-4-yl]-N-methanimidoylmethanimidamide |
|---|---|
| PubChem CID | 123478734 |
| Molecular Formula | C25H31F2N5O2S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N-[1-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperidin-4-yl]-N-methanimidoylmethanimidamide |
| SMILES | [H]/N=C/N(/C=N/[H])C1CCN(c2cc(F)c(CN3C(C)CCC(c4ccccc4)S3(=O)=O)cc2F)CC1 |
| InChI | InChI=1S/C25H31F2N5O2S/c1-18-7-8-25(19-5-3-2-4-6-19)35(33,34)32(18)15-20-13-23(27)24(14-22(20)26)30-11-9-21(10-12-30)31(16-28)17-29/h2-6,13-14,16-18,21,25,28-29H,7-12,15H2,1H3/b28-16+,29-17+ |
| InChIKey | JUCDYIJWSVCFPS-LPHFKDDMSA-N |
| XLogP | 4.51 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|