C24H27F2N3O4S — CID 137102014
tert-butyl 2-diazo-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate (PubChem CID 137102014) has the molecular formula C24H27F2N3O4S and a molecular weight of 491.56 g/mol. Its IUPAC name is tert-butyl 2-diazo-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate.
| Compound Name | tert-butyl 2-diazo-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 137102014 |
| Molecular Formula | C24H27F2N3O4S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | tert-butyl 2-diazo-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]acetate |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(C(=[N+]=[N-])C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C24H27F2N3O4S/c1-15-10-11-21(16-8-6-5-7-9-16)34(31,32)29(15)14-17-12-20(26)18(13-19(17)25)22(28-27)23(30)33-24(2,3)4/h5-9,12-13,15,21H,10-11,14H2,1-4H3/t15-,21+/m0/s1 |
| InChIKey | RLXQQHDZLAWUSD-YCRPNKLZSA-N |
| XLogP | 4.38 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|