C15H12F4O7S2 — CID 139531576
(2S)-4-[4-fluoro-6-methoxy-5-(trifluoromethylsulfonyloxy)-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid (PubChem CID 139531576) has the molecular formula C15H12F4O7S2 and a molecular weight of 444.38 g/mol. Its IUPAC name is (2S)-4-[4-fluoro-6-methoxy-5-(trifluoromethylsulfonyloxy)-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-[4-fluoro-6-methoxy-5-(trifluoromethylsulfonyloxy)-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139531576 |
| Molecular Formula | C15H12F4O7S2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | (2S)-4-[4-fluoro-6-methoxy-5-(trifluoromethylsulfonyloxy)-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)C[C@H](C)C(=O)O)cc2c(F)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H12F4O7S2/c1-6(14(21)22)3-8(20)11-4-7-10(27-11)5-9(25-2)13(12(7)16)26-28(23,24)15(17,18)19/h4-6H,3H2,1-2H3,(H,21,22)/t6-/m0/s1 |
| InChIKey | JQSIRORVFXGFNQ-LURJTMIESA-N |
| XLogP | 3.57 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|