C17H18BrFO4S — CID 139531780
(2S)-4-[5-(3-bromopropyl)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid (PubChem CID 139531780) has the molecular formula C17H18BrFO4S and a molecular weight of 417.30 g/mol. Its IUPAC name is (2S)-4-[5-(3-bromopropyl)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-[5-(3-bromopropyl)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139531780 |
| Molecular Formula | C17H18BrFO4S |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | (2S)-4-[5-(3-bromopropyl)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)C[C@H](C)C(=O)O)cc2c(F)c1CCCBr |
| InChI | InChI=1S/C17H18BrFO4S/c1-9(17(21)22)6-12(20)15-7-11-14(24-15)8-13(23-2)10(16(11)19)4-3-5-18/h7-9H,3-6H2,1-2H3,(H,21,22)/t9-/m0/s1 |
| InChIKey | OODYVBPUYFCLJP-VIFPVBQESA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|