C20H24BrFO5S — CID 139532164
methyl 4-[5-(5-bromopentoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoate (PubChem CID 139532164) has the molecular formula C20H24BrFO5S and a molecular weight of 475.38 g/mol. Its IUPAC name is methyl 4-[5-(5-bromopentoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoate.
| Compound Name | methyl 4-[5-(5-bromopentoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 139532164 |
| Molecular Formula | C20H24BrFO5S |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | methyl 4-[5-(5-bromopentoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoate |
| SMILES | COC(=O)C(C)CC(=O)c1cc2c(F)c(OCCCCCBr)c(OC)cc2s1 |
| InChI | InChI=1S/C20H24BrFO5S/c1-12(20(24)26-3)9-14(23)17-10-13-16(28-17)11-15(25-2)19(18(13)22)27-8-6-4-5-7-21/h10-12H,4-9H2,1-3H3 |
| InChIKey | WQQRNOQJTHERMF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|