C18H20BrFO5S — CID 139531714
4-[5-(3-bromobutoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid (PubChem CID 139531714) has the molecular formula C18H20BrFO5S and a molecular weight of 447.32 g/mol. Its IUPAC name is 4-[5-(3-bromobutoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-[5-(3-bromobutoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139531714 |
| Molecular Formula | C18H20BrFO5S |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 4-[5-(3-bromobutoxy)-4-fluoro-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)CC(C)C(=O)O)cc2c(F)c1OCCC(C)Br |
| InChI | InChI=1S/C18H20BrFO5S/c1-9(18(22)23)6-12(21)15-7-11-14(26-15)8-13(24-3)17(16(11)20)25-5-4-10(2)19/h7-10H,4-6H2,1-3H3,(H,22,23) |
| InChIKey | IRNWUBLAWRVDIT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|