C49H47NS2 — CID 139539714
9-cyclohexa-1,3-dien-1-yl-2-(6'-phenylspiro[1,2,4a,5,6,7,9a,10a-octahydrothioxanthene-9,9'-5,6-dihydrothioxanthene]-2'-yl)-1,2,7,8-tetrahydrocarbazole (PubChem CID 139539714) has the molecular formula C49H47NS2 and a molecular weight of 714.06 g/mol. Its IUPAC name is 9-cyclohexa-1,3-dien-1-yl-2-(6'-phenylspiro[1,2,4a,5,6,7,9a,10a-octahydrothioxanthene-9,9'-5,6-dihydrothioxanthene]-2'-yl)-1,2,7,8-tetrahydrocarbazole.
| Compound Name | 9-cyclohexa-1,3-dien-1-yl-2-(6'-phenylspiro[1,2,4a,5,6,7,9a,10a-octahydrothioxanthene-9,9'-5,6-dihydrothioxanthene]-2'-yl)-1,2,7,8-tetrahydrocarbazole |
|---|---|
| PubChem CID | 139539714 |
| Molecular Formula | C49H47NS2 |
| Molecular Weight | 714.06 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | 9-cyclohexa-1,3-dien-1-yl-2-(6'-phenylspiro[1,2,4a,5,6,7,9a,10a-octahydrothioxanthene-9,9'-5,6-dihydrothioxanthene]-2'-yl)-1,2,7,8-tetrahydrocarbazole |
| SMILES | C1=CCCC(n2c3c(c4c2CC(c2ccc5c(c2)C2(C6=CCCCC6SC6C=CCCC62)C2=C(CC(c6ccccc6)C=C2)S5)C=C4)C=CCC3)=C1 |
| InChI | InChI=1S/C49H47NS2/c1-3-13-32(14-4-1)35-24-27-41-48(31-35)52-47-28-25-33(29-42(47)49(41)39-18-8-11-21-45(39)51-46-22-12-9-19-40(46)49)34-23-26-38-37-17-7-10-20-43(37)50(44(38)30-34)36-15-5-2-6-16-36/h1-5,7,11,13-15,17,19,21,23-29,34-35,39,45-46H,6,8-10,12,16,18,20,22,30-31H2 |
| InChIKey | DDLVIGDZQGDTON-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.06 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|