C23H26FN7O2 — CID 139540952
6-[4-[(Z)-2-amino-1-(N-amino-4-fluoroanilino)prop-1-enyl]imidazol-1-yl]-N-(oxan-4-yl)pyridine-3-carboxamide (PubChem CID 139540952) has the molecular formula C23H26FN7O2 and a molecular weight of 451.51 g/mol. Its IUPAC name is 6-[4-[(Z)-2-amino-1-(N-amino-4-fluoroanilino)prop-1-enyl]imidazol-1-yl]-N-(oxan-4-yl)pyridine-3-carboxamide.
| Compound Name | 6-[4-[(Z)-2-amino-1-(N-amino-4-fluoroanilino)prop-1-enyl]imidazol-1-yl]-N-(oxan-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139540952 |
| Molecular Formula | C23H26FN7O2 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 6-[4-[(Z)-2-amino-1-(N-amino-4-fluoroanilino)prop-1-enyl]imidazol-1-yl]-N-(oxan-4-yl)pyridine-3-carboxamide |
| SMILES | C/C(N)=C(\c1cn(-c2ccc(C(=O)NC3CCOCC3)cn2)cn1)N(N)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN7O2/c1-15(25)22(31(26)19-5-3-17(24)4-6-19)20-13-30(14-28-20)21-7-2-16(12-27-21)23(32)29-18-8-10-33-11-9-18/h2-7,12-14,18H,8-11,25-26H2,1H3,(H,29,32)/b22-15- |
| InChIKey | AHZGNNNZNQJDNP-JCMHNJIXSA-N |
| XLogP | 2.34 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|