C17H18BrN3O4S — CID 139541329
5-bromo-N-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methylcarbamothioyl]furan-2-carboxamide (PubChem CID 139541329) has the molecular formula C17H18BrN3O4S and a molecular weight of 440.32 g/mol. Its IUPAC name is 5-bromo-N-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methylcarbamothioyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methylcarbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 139541329 |
| Molecular Formula | C17H18BrN3O4S |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 5-bromo-N-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methylcarbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCC(=O)NCNC(=S)NC(=O)c2ccc(Br)o2)c(C)c1 |
| InChI | InChI=1S/C17H18BrN3O4S/c1-10-3-4-12(11(2)7-10)24-8-15(22)19-9-20-17(26)21-16(23)13-5-6-14(18)25-13/h3-7H,8-9H2,1-2H3,(H,19,22)(H2,20,21,23,26) |
| InChIKey | NIUALVQDYOWAPZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|