C19H19F3IN3O — CID 139541452
N-[2-[2-(dimethylamino)aziridin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide (PubChem CID 139541452) has the molecular formula C19H19F3IN3O and a molecular weight of 489.28 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)aziridin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[2-[2-(dimethylamino)aziridin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 139541452 |
| Molecular Formula | C19H19F3IN3O |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-[2-[2-(dimethylamino)aziridin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CC2N(C)C)cc1I |
| InChI | InChI=1S/C19H19F3IN3O/c1-11-4-5-12(8-14(11)23)18(27)24-15-9-13(19(20,21)22)6-7-16(15)26-10-17(26)25(2)3/h4-9,17H,10H2,1-3H3,(H,24,27) |
| InChIKey | ZVFCXYRNNLUPLL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|