C21H23F3IN3O — CID 59428012
N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide (PubChem CID 59428012) has the molecular formula C21H23F3IN3O and a molecular weight of 517.33 g/mol. Its IUPAC name is N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 59428012 |
| Molecular Formula | C21H23F3IN3O |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CC[C@@H](N(C)C)C2)cc1I |
| InChI | InChI=1S/C21H23F3IN3O/c1-13-4-5-14(10-17(13)25)20(29)26-18-11-15(21(22,23)24)6-7-19(18)28-9-8-16(12-28)27(2)3/h4-7,10-11,16H,8-9,12H2,1-3H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | HCWWSNYFWAZYKG-MRXNPFEDSA-N |
| XLogP | 5.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|