C22H26FNO4S — CID 139542266
4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-ol (PubChem CID 139542266) has the molecular formula C22H26FNO4S and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-ol.
| Compound Name | 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-ol |
|---|---|
| PubChem CID | 139542266 |
| Molecular Formula | C22H26FNO4S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-ol |
| SMILES | O=S1(=O)[C@@H](c2ccccc2)CCCN1Cc1ccc(C2(O)CCOCC2)cc1F |
| InChI | InChI=1S/C22H26FNO4S/c23-20-15-19(22(25)10-13-28-14-11-22)9-8-18(20)16-24-12-4-7-21(29(24,26)27)17-5-2-1-3-6-17/h1-3,5-6,8-9,15,21,25H,4,7,10-14,16H2/t21-/m1/s1 |
| InChIKey | XWOYWLRHOIEXKJ-OAQYLSRUSA-N |
| XLogP | 3.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |