C23H40N2 — CID 139545886
1-(3,3-dimethylbutyl)-4-[4-(4,4-dimethylpentan-2-yl)phenyl]piperazine (PubChem CID 139545886) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-4-[4-(4,4-dimethylpentan-2-yl)phenyl]piperazine.
| Compound Name | 1-(3,3-dimethylbutyl)-4-[4-(4,4-dimethylpentan-2-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 139545886 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-4-[4-(4,4-dimethylpentan-2-yl)phenyl]piperazine |
| SMILES | CC(CC(C)(C)C)c1ccc(N2CCN(CCC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H40N2/c1-19(18-23(5,6)7)20-8-10-21(11-9-20)25-16-14-24(15-17-25)13-12-22(2,3)4/h8-11,19H,12-18H2,1-7H3 |
| InChIKey | NDNDWCLFWJUYST-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|