C19H27ClN2O6 — CID 139548082
[2-[(4-chlorobenzoyl)amino]oxy-2-methylpropanoyl]oxymethyl 2-(aminomethyl)-2-ethylbutanoate (PubChem CID 139548082) has the molecular formula C19H27ClN2O6 and a molecular weight of 414.89 g/mol. Its IUPAC name is [2-[(4-chlorobenzoyl)amino]oxy-2-methylpropanoyl]oxymethyl 2-(aminomethyl)-2-ethylbutanoate.
| Compound Name | [2-[(4-chlorobenzoyl)amino]oxy-2-methylpropanoyl]oxymethyl 2-(aminomethyl)-2-ethylbutanoate |
|---|---|
| PubChem CID | 139548082 |
| Molecular Formula | C19H27ClN2O6 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-[(4-chlorobenzoyl)amino]oxy-2-methylpropanoyl]oxymethyl 2-(aminomethyl)-2-ethylbutanoate |
| SMILES | CCC(CC)(CN)C(=O)OCOC(=O)C(C)(C)ONC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN2O6/c1-5-19(6-2,11-21)17(25)27-12-26-16(24)18(3,4)28-22-15(23)13-7-9-14(20)10-8-13/h7-10H,5-6,11-12,21H2,1-4H3,(H,22,23) |
| InChIKey | TXSIIYUIIIFLCN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|