C21H21FN4O4 — CID 139551657
N-(3-cyano-4-fluorophenyl)-1,2,4-trimethyl-5-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]acetyl]pyrrole-3-carboxamide (PubChem CID 139551657) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-1,2,4-trimethyl-5-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]acetyl]pyrrole-3-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-1,2,4-trimethyl-5-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]acetyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 139551657 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-1,2,4-trimethyl-5-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]acetyl]pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)c(C#N)c2)c(C)n(C)c1C(=O)C(=O)N[C@H]1CCOC1 |
| InChI | InChI=1S/C21H21FN4O4/c1-11-17(20(28)24-14-4-5-16(22)13(8-14)9-23)12(2)26(3)18(11)19(27)21(29)25-15-6-7-30-10-15/h4-5,8,15H,6-7,10H2,1-3H3,(H,24,28)(H,25,29)/t15-/m0/s1 |
| InChIKey | QKHNPFYGAXMSON-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|