C27H28O8 — CID 139556293
2-(2-methylprop-2-enoyloxy)ethyl 4-[4-(1-hydroxy-2-methylprop-2-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]benzoate (PubChem CID 139556293) has the molecular formula C27H28O8 and a molecular weight of 480.51 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-[4-(1-hydroxy-2-methylprop-2-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]benzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-[4-(1-hydroxy-2-methylprop-2-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 139556293 |
| Molecular Formula | C27H28O8 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-[4-(1-hydroxy-2-methylprop-2-enoxy)-3-(2-methylprop-2-enoyloxy)phenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(-c2ccc(OC(O)C(=C)C)c(OC(=O)C(=C)C)c2)cc1 |
| InChI | InChI=1S/C27H28O8/c1-16(2)24(28)32-13-14-33-27(31)20-9-7-19(8-10-20)21-11-12-22(34-25(29)17(3)4)23(15-21)35-26(30)18(5)6/h7-12,15,25,29H,1,3,5,13-14H2,2,4,6H3 |
| InChIKey | AFMQUWRUNFMMRB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|