C17H23N5O2 — CID 139560078
3-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine (PubChem CID 139560078) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine.
| Compound Name | 3-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine |
|---|---|
| PubChem CID | 139560078 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine |
| SMILES | NC1CCCCC1.[N-]=[N+]=NC(CC(=O)O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H10N4O2.C6H13N/c12-15-14-10(5-11(16)17)8-6-13-9-4-2-1-3-7(8)9;7-6-4-2-1-3-5-6/h1-4,6,10,13H,5H2,(H,16,17);6H,1-5,7H2 |
| InChIKey | BXLCMFVRHSGRDS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|