C26H25N3O3 — CID 139561951
ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indole-6-carbonyl]amino]phenyl]acetate (PubChem CID 139561951) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indole-6-carbonyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indole-6-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 139561951 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indole-6-carbonyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1NC(=O)c1cc(-c2cccc(CN)c2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C26H25N3O3/c1-2-32-25(30)15-19-7-3-4-9-23(19)29-26(31)20-13-22(21-10-11-28-24(21)14-20)18-8-5-6-17(12-18)16-27/h3-14,28H,2,15-16,27H2,1H3,(H,29,31) |
| InChIKey | HSKYEBKIDRHYFX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |