C25H26N4O3 — CID 156569798
4-[3-(aminomethyl)phenyl]-N-[2-(2-ethoxy-2-hydroxyethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-6-carboxamide (PubChem CID 156569798) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-[3-(aminomethyl)phenyl]-N-[2-(2-ethoxy-2-hydroxyethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-6-carboxamide.
| Compound Name | 4-[3-(aminomethyl)phenyl]-N-[2-(2-ethoxy-2-hydroxyethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 156569798 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-[3-(aminomethyl)phenyl]-N-[2-(2-ethoxy-2-hydroxyethyl)phenyl]-1H-pyrrolo[2,3-b]pyridine-6-carboxamide |
| SMILES | CCOC(O)Cc1ccccc1NC(=O)c1cc(-c2cccc(CN)c2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C25H26N4O3/c1-2-32-23(30)13-18-7-3-4-9-21(18)29-25(31)22-14-20(19-10-11-27-24(19)28-22)17-8-5-6-16(12-17)15-26/h3-12,14,23,30H,2,13,15,26H2,1H3,(H,27,28)(H,29,31) |
| InChIKey | HBFAURASVPDBAM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|