C26H23BrN2O5S — CID 139561989
ethyl 2-[2-[[7-bromo-1-(4-methylphenyl)sulfonylindole-5-carbonyl]amino]phenyl]acetate (PubChem CID 139561989) has the molecular formula C26H23BrN2O5S and a molecular weight of 555.45 g/mol. Its IUPAC name is ethyl 2-[2-[[7-bromo-1-(4-methylphenyl)sulfonylindole-5-carbonyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-bromo-1-(4-methylphenyl)sulfonylindole-5-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 139561989 |
| Molecular Formula | C26H23BrN2O5S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | ethyl 2-[2-[[7-bromo-1-(4-methylphenyl)sulfonylindole-5-carbonyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1NC(=O)c1cc(Br)c2c(ccn2S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C26H23BrN2O5S/c1-3-34-24(30)16-18-6-4-5-7-23(18)28-26(31)20-14-19-12-13-29(25(19)22(27)15-20)35(32,33)21-10-8-17(2)9-11-21/h4-15H,3,16H2,1-2H3,(H,28,31) |
| InChIKey | CBGWDOUOHCCIOI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |