C16H18N2O6S — CID 8593740
ethyl 4-[3-(4-methylphenyl)sulfonyl-2-oxoimidazol-1-yl]-4-oxobutanoate (PubChem CID 8593740) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is ethyl 4-[3-(4-methylphenyl)sulfonyl-2-oxoimidazol-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-(4-methylphenyl)sulfonyl-2-oxoimidazol-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 8593740 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | ethyl 4-[3-(4-methylphenyl)sulfonyl-2-oxoimidazol-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)n1ccn(S(=O)(=O)c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C16H18N2O6S/c1-3-24-15(20)9-8-14(19)17-10-11-18(16(17)21)25(22,23)13-6-4-12(2)5-7-13/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | OSXJMDJAOYNHFY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |