C15H17ClN2O4S — CID 8593825
1-(4-chlorophenyl)sulfonyl-3-(3,3-dimethylbutanoyl)imidazol-2-one (PubChem CID 8593825) has the molecular formula C15H17ClN2O4S and a molecular weight of 356.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-(3,3-dimethylbutanoyl)imidazol-2-one.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-(3,3-dimethylbutanoyl)imidazol-2-one |
|---|---|
| PubChem CID | 8593825 |
| Molecular Formula | C15H17ClN2O4S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-(3,3-dimethylbutanoyl)imidazol-2-one |
| SMILES | CC(C)(C)CC(=O)n1ccn(S(=O)(=O)c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C15H17ClN2O4S/c1-15(2,3)10-13(19)17-8-9-18(14(17)20)23(21,22)12-6-4-11(16)5-7-12/h4-9H,10H2,1-3H3 |
| InChIKey | DNAYBLJJDLNFSP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |