C17H12Cl2N2O4S — CID 8593771
1-(2,5-dichlorobenzoyl)-3-(4-methylphenyl)sulfonylimidazol-2-one (PubChem CID 8593771) has the molecular formula C17H12Cl2N2O4S and a molecular weight of 411.27 g/mol. Its IUPAC name is 1-(2,5-dichlorobenzoyl)-3-(4-methylphenyl)sulfonylimidazol-2-one.
| Compound Name | 1-(2,5-dichlorobenzoyl)-3-(4-methylphenyl)sulfonylimidazol-2-one |
|---|---|
| PubChem CID | 8593771 |
| Molecular Formula | C17H12Cl2N2O4S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 1-(2,5-dichlorobenzoyl)-3-(4-methylphenyl)sulfonylimidazol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccn(C(=O)c3cc(Cl)ccc3Cl)c2=O)cc1 |
| InChI | InChI=1S/C17H12Cl2N2O4S/c1-11-2-5-13(6-3-11)26(24,25)21-9-8-20(17(21)23)16(22)14-10-12(18)4-7-15(14)19/h2-10H,1H3 |
| InChIKey | STXMYVIFDXBRQV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |