C18H15ClN2O4S — CID 8593851
1-(4-chlorophenyl)sulfonyl-3-(3,4-dimethylbenzoyl)imidazol-2-one (PubChem CID 8593851) has the molecular formula C18H15ClN2O4S and a molecular weight of 390.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-(3,4-dimethylbenzoyl)imidazol-2-one.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-(3,4-dimethylbenzoyl)imidazol-2-one |
|---|---|
| PubChem CID | 8593851 |
| Molecular Formula | C18H15ClN2O4S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-(3,4-dimethylbenzoyl)imidazol-2-one |
| SMILES | Cc1ccc(C(=O)n2ccn(S(=O)(=O)c3ccc(Cl)cc3)c2=O)cc1C |
| InChI | InChI=1S/C18H15ClN2O4S/c1-12-3-4-14(11-13(12)2)17(22)20-9-10-21(18(20)23)26(24,25)16-7-5-15(19)6-8-16/h3-11H,1-2H3 |
| InChIKey | CUEFHEFHJMGJMI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |