C26H28F2N4O3S — CID 139562639
1-(2,4-difluorophenyl)-N-(3-ethylhex-5-enyl)-4-oxo-7-(1-oxo-1,3-thiazolidin-3-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 139562639) has the molecular formula C26H28F2N4O3S and a molecular weight of 514.60 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(3-ethylhex-5-enyl)-4-oxo-7-(1-oxo-1,3-thiazolidin-3-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-N-(3-ethylhex-5-enyl)-4-oxo-7-(1-oxo-1,3-thiazolidin-3-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 139562639 |
| Molecular Formula | C26H28F2N4O3S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(3-ethylhex-5-enyl)-4-oxo-7-(1-oxo-1,3-thiazolidin-3-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | C=CCC(CC)CCNC(=O)c1cn(-c2ccc(F)cc2F)c2nc(N3CCS(=O)C3)ccc2c1=O |
| InChI | InChI=1S/C26H28F2N4O3S/c1-3-5-17(4-2)10-11-29-26(34)20-15-32(22-8-6-18(27)14-21(22)28)25-19(24(20)33)7-9-23(30-25)31-12-13-36(35)16-31/h3,6-9,14-15,17H,1,4-5,10-13,16H2,2H3,(H,29,34) |
| InChIKey | TVQCAHKQTHHVCX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|