C23H22F4 — CID 139563176
2,2,3,3-tetrafluoro-6-[5-(3-methylphenyl)hexa-1,5-dien-2-yl]-1,4-dihydronaphthalene (PubChem CID 139563176) has the molecular formula C23H22F4 and a molecular weight of 374.42 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-6-[5-(3-methylphenyl)hexa-1,5-dien-2-yl]-1,4-dihydronaphthalene.
| Compound Name | 2,2,3,3-tetrafluoro-6-[5-(3-methylphenyl)hexa-1,5-dien-2-yl]-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139563176 |
| Molecular Formula | C23H22F4 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2,2,3,3-tetrafluoro-6-[5-(3-methylphenyl)hexa-1,5-dien-2-yl]-1,4-dihydronaphthalene |
| SMILES | C=C(CCC(=C)c1ccc2c(c1)CC(F)(F)C(F)(F)C2)c1cccc(C)c1 |
| InChI | InChI=1S/C23H22F4/c1-15-5-4-6-18(11-15)16(2)7-8-17(3)19-9-10-20-13-22(24,25)23(26,27)14-21(20)12-19/h4-6,9-12H,2-3,7-8,13-14H2,1H3 |
| InChIKey | HGBXXNRFWYHPPB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|