About 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole
5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole (PubChem CID 139563365) has the molecular formula C17H16N4
and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole.
Molecular Properties
| Compound Name | 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole |
| PubChem CID | 139563365 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole |
| SMILES | C=C(CCC(=C)c1ccc2[nH]ncc2c1)c1ccnnc1 |
| InChI | InChI=1S/C17H16N4/c1-12(3-4-13(2)15-7-8-18-19-10-15)14-5-6-17-16(9-14)11-20-21-17/h5-11H,1-4H2,(H,20,21) |
| InChIKey | ZZPMREJWTPKNTL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole?
The IUPAC name of 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole (CID 139563365) is 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole.
What is the SMILES notation for 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole?
The canonical SMILES for 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole is C=C(CCC(=C)c1ccc2[nH]ncc2c1)c1ccnnc1.
What is the InChIKey of 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole?
The InChIKey is ZZPMREJWTPKNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4/c1-12(3-4-13(2)15-7-8-18-19-10-15)14-5-6-17-16(9-14)11-20-21-17/h5-11H,1-4H2,(H,20,21).
What are the key properties of 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole?
5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole has a molecular weight of 276.34 g/mol, XLogP of 3.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-pyridazin-4-ylhexa-1,5-dien-2-yl)-1H-indazole is sourced from PubChem (CID 139563365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).