C17H16N2S — CID 139563228
5-(5-thiophen-2-ylhexa-1,5-dien-2-yl)-1H-indazole (PubChem CID 139563228) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 5-(5-thiophen-2-ylhexa-1,5-dien-2-yl)-1H-indazole.
| Compound Name | 5-(5-thiophen-2-ylhexa-1,5-dien-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 139563228 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-(5-thiophen-2-ylhexa-1,5-dien-2-yl)-1H-indazole |
| SMILES | C=C(CCC(=C)c1cccs1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C17H16N2S/c1-12(5-6-13(2)17-4-3-9-20-17)14-7-8-16-15(10-14)11-18-19-16/h3-4,7-11H,1-2,5-6H2,(H,18,19) |
| InChIKey | IOAJTGBSBXDQMA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |