C20H20N2 — CID 139563240
5-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-1H-indazole (PubChem CID 139563240) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-1H-indazole.
| Compound Name | 5-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-1H-indazole |
|---|---|
| PubChem CID | 139563240 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-1H-indazole |
| SMILES | C=C(CCC(=C)c1ccccc1C)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C20H20N2/c1-14(17-10-11-20-18(12-17)13-21-22-20)8-9-16(3)19-7-5-4-6-15(19)2/h4-7,10-13H,1,3,8-9H2,2H3,(H,21,22) |
| InChIKey | WCTXVSLFOIMECW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |