C21H21N — CID 139563239
6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole (PubChem CID 139563239) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole.
| Compound Name | 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole |
|---|---|
| PubChem CID | 139563239 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole |
| SMILES | C=C(CCC(=C)c1ccccc1C)c1ccc2c(c1)N=CC2 |
| InChI | InChI=1S/C21H21N/c1-15(19-11-10-18-12-13-22-21(18)14-19)8-9-17(3)20-7-5-4-6-16(20)2/h4-7,10-11,13-14H,1,3,8-9,12H2,2H3 |
| InChIKey | DOVDBIGJMIJFGZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |