About 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole
6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole (PubChem CID 139563239) has the molecular formula C21H21N
and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole.
Molecular Properties
| Compound Name | 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole |
| PubChem CID | 139563239 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole |
| SMILES | C=C(CCC(=C)c1ccccc1C)c1ccc2c(c1)N=CC2 |
| InChI | InChI=1S/C21H21N/c1-15(19-11-10-18-12-13-22-21(18)14-19)8-9-17(3)20-7-5-4-6-16(20)2/h4-7,10-11,13-14H,1,3,8-9,12H2,2H3 |
| InChIKey | DOVDBIGJMIJFGZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole?
The IUPAC name of 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole (CID 139563239) is 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole.
What is the SMILES notation for 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole?
The canonical SMILES for 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole is C=C(CCC(=C)c1ccccc1C)c1ccc2c(c1)N=CC2.
What is the InChIKey of 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole?
The InChIKey is DOVDBIGJMIJFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N/c1-15(19-11-10-18-12-13-22-21(18)14-19)8-9-17(3)20-7-5-4-6-16(20)2/h4-7,10-11,13-14H,1,3,8-9,12H2,2H3.
What are the key properties of 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole?
6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole has a molecular weight of 287.41 g/mol, XLogP of 5.76, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(2-methylphenyl)hexa-1,5-dien-2-yl]-3H-indole is sourced from PubChem (CID 139563239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).