C20H18FN — CID 139563099
5-[5-(2-fluorophenyl)hexa-1,5-dien-2-yl]-1H-indole (PubChem CID 139563099) has the molecular formula C20H18FN and a molecular weight of 291.37 g/mol. Its IUPAC name is 5-[5-(2-fluorophenyl)hexa-1,5-dien-2-yl]-1H-indole.
| Compound Name | 5-[5-(2-fluorophenyl)hexa-1,5-dien-2-yl]-1H-indole |
|---|---|
| PubChem CID | 139563099 |
| Molecular Formula | C20H18FN |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-[5-(2-fluorophenyl)hexa-1,5-dien-2-yl]-1H-indole |
| SMILES | C=C(CCC(=C)c1ccccc1F)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C20H18FN/c1-14(16-9-10-20-17(13-16)11-12-22-20)7-8-15(2)18-5-3-4-6-19(18)21/h3-6,9-13,22H,1-2,7-8H2 |
| InChIKey | UKCWEGCGRWWHFK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |