C20H19N — CID 139563102
2-[5-(1H-inden-5-yl)hexa-1,5-dien-2-yl]pyridine (PubChem CID 139563102) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[5-(1H-inden-5-yl)hexa-1,5-dien-2-yl]pyridine.
| Compound Name | 2-[5-(1H-inden-5-yl)hexa-1,5-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 139563102 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[5-(1H-inden-5-yl)hexa-1,5-dien-2-yl]pyridine |
| SMILES | C=C(CCC(=C)c1ccccn1)c1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C20H19N/c1-15(9-10-16(2)20-8-3-4-13-21-20)18-12-11-17-6-5-7-19(17)14-18/h3-5,7-8,11-14H,1-2,6,9-10H2 |
| InChIKey | SAOWYWLQUNYKKW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |