C19H17NS — CID 139563253
2-[5-(1-benzothiophen-5-yl)hexa-1,5-dien-2-yl]pyridine (PubChem CID 139563253) has the molecular formula C19H17NS and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-[5-(1-benzothiophen-5-yl)hexa-1,5-dien-2-yl]pyridine.
| Compound Name | 2-[5-(1-benzothiophen-5-yl)hexa-1,5-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 139563253 |
| Molecular Formula | C19H17NS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[5-(1-benzothiophen-5-yl)hexa-1,5-dien-2-yl]pyridine |
| SMILES | C=C(CCC(=C)c1ccccn1)c1ccc2sccc2c1 |
| InChI | InChI=1S/C19H17NS/c1-14(6-7-15(2)18-5-3-4-11-20-18)16-8-9-19-17(13-16)10-12-21-19/h3-5,8-13H,1-2,6-7H2 |
| InChIKey | RIKHKNZFEDPXMZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |