C18H13N3O — CID 167961084
(Z)-3-(1H-indazol-5-yl)-2-(2-methylbenzoyl)prop-2-enenitrile (PubChem CID 167961084) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is (Z)-3-(1H-indazol-5-yl)-2-(2-methylbenzoyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(1H-indazol-5-yl)-2-(2-methylbenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 167961084 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (Z)-3-(1H-indazol-5-yl)-2-(2-methylbenzoyl)prop-2-enenitrile |
| SMILES | Cc1ccccc1C(=O)/C(C#N)=C\c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C18H13N3O/c1-12-4-2-3-5-16(12)18(22)14(10-19)8-13-6-7-17-15(9-13)11-20-21-17/h2-9,11H,1H3,(H,20,21)/b14-8- |
| InChIKey | DBEWWAKAOBUXFZ-ZSOIEALJSA-N |
| XLogP | 3.66 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|