C18H30N6O2S2 — CID 139565230
3-methyl-N-[5-[4-[5-(3-methylbutanoylamino)-1,3,4-thiadiazol-2-yl]butyl]-2,3-dihydro-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 139565230) has the molecular formula C18H30N6O2S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 3-methyl-N-[5-[4-[5-(3-methylbutanoylamino)-1,3,4-thiadiazol-2-yl]butyl]-2,3-dihydro-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 3-methyl-N-[5-[4-[5-(3-methylbutanoylamino)-1,3,4-thiadiazol-2-yl]butyl]-2,3-dihydro-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 139565230 |
| Molecular Formula | C18H30N6O2S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-methyl-N-[5-[4-[5-(3-methylbutanoylamino)-1,3,4-thiadiazol-2-yl]butyl]-2,3-dihydro-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC(C)CC(=O)Nc1nnc(CCCCC2=NNC(NC(=O)CC(C)C)S2)s1 |
| InChI | InChI=1S/C18H30N6O2S2/c1-11(2)9-13(25)19-17-23-21-15(27-17)7-5-6-8-16-22-24-18(28-16)20-14(26)10-12(3)4/h11-12,17,23H,5-10H2,1-4H3,(H,19,25)(H,20,24,26) |
| InChIKey | BRAIILOKAMMKDL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|