C9H14O9P2S — CID 139571018
2-(3-methylphenyl)sulfonylethyl phosphono hydrogen phosphate (PubChem CID 139571018) has the molecular formula C9H14O9P2S and a molecular weight of 360.22 g/mol. Its IUPAC name is 2-(3-methylphenyl)sulfonylethyl phosphono hydrogen phosphate.
| Compound Name | 2-(3-methylphenyl)sulfonylethyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 139571018 |
| Molecular Formula | C9H14O9P2S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 2-(3-methylphenyl)sulfonylethyl phosphono hydrogen phosphate |
| SMILES | Cc1cccc(S(=O)(=O)CCOP(=O)(O)OP(=O)(O)O)c1 |
| InChI | InChI=1S/C9H14O9P2S/c1-8-3-2-4-9(7-8)21(15,16)6-5-17-20(13,14)18-19(10,11)12/h2-4,7H,5-6H2,1H3,(H,13,14)(H2,10,11,12) |
| InChIKey | GJHNNFMBHNSQJK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|