C12H16NO8PS — CID 88793470
2-[3-(3-oxobutanoylamino)phenyl]sulfonylethyl dihydrogen phosphate (PubChem CID 88793470) has the molecular formula C12H16NO8PS and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-[3-(3-oxobutanoylamino)phenyl]sulfonylethyl dihydrogen phosphate.
| Compound Name | 2-[3-(3-oxobutanoylamino)phenyl]sulfonylethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 88793470 |
| Molecular Formula | C12H16NO8PS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-[3-(3-oxobutanoylamino)phenyl]sulfonylethyl dihydrogen phosphate |
| SMILES | CC(=O)CC(=O)Nc1cccc(S(=O)(=O)CCOP(=O)(O)O)c1 |
| InChI | InChI=1S/C12H16NO8PS/c1-9(14)7-12(15)13-10-3-2-4-11(8-10)23(19,20)6-5-21-22(16,17)18/h2-4,8H,5-7H2,1H3,(H,13,15)(H2,16,17,18) |
| InChIKey | JYFDJDSDDCJWBY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|