C24H24FN5O3 — CID 139571765
(2R,3R,4S)-4-[2-benzyl-6-(benzylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 139571765) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is (2R,3R,4S)-4-[2-benzyl-6-(benzylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S)-4-[2-benzyl-6-(benzylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 139571765 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (2R,3R,4S)-4-[2-benzyl-6-(benzylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1OC[C@@](F)(n2cnc3c(NCc4ccccc4)nc(Cc4ccccc4)nc32)[C@@H]1O |
| InChI | InChI=1S/C24H24FN5O3/c25-24(14-33-18(13-31)21(24)32)30-15-27-20-22(26-12-17-9-5-2-6-10-17)28-19(29-23(20)30)11-16-7-3-1-4-8-16/h1-10,15,18,21,31-32H,11-14H2,(H,26,28,29)/t18-,21-,24-/m1/s1 |
| InChIKey | QEAJFCZRFVWUHC-MEKIYTOJSA-N |
| XLogP | 2.40 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |