C22H15NO4S — CID 139572427
2-oxo-3-(4-phenoxyphenyl)sulfanyl-1H-quinoline-4-carboxylic acid (PubChem CID 139572427) has the molecular formula C22H15NO4S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-oxo-3-(4-phenoxyphenyl)sulfanyl-1H-quinoline-4-carboxylic acid.
| Compound Name | 2-oxo-3-(4-phenoxyphenyl)sulfanyl-1H-quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 139572427 |
| Molecular Formula | C22H15NO4S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-oxo-3-(4-phenoxyphenyl)sulfanyl-1H-quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1c(Sc2ccc(Oc3ccccc3)cc2)c(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H15NO4S/c24-21-20(19(22(25)26)17-8-4-5-9-18(17)23-21)28-16-12-10-15(11-13-16)27-14-6-2-1-3-7-14/h1-13H,(H,23,24)(H,25,26) |
| InChIKey | HLONOROUPABRQF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |