About 2-(2-iodopropyl)pentane-1,3-diamine
2-(2-iodopropyl)pentane-1,3-diamine (PubChem CID 139572582) has the molecular formula C8H19IN2
and a molecular weight of 270.16 g/mol. Its IUPAC name is 2-(2-iodopropyl)pentane-1,3-diamine.
Molecular Properties
| Compound Name | 2-(2-iodopropyl)pentane-1,3-diamine |
| PubChem CID | 139572582 |
| Molecular Formula | C8H19IN2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(2-iodopropyl)pentane-1,3-diamine |
| SMILES | CCC(N)C(CN)CC(C)I |
| InChI | InChI=1S/C8H19IN2/c1-3-8(11)7(5-10)4-6(2)9/h6-8H,3-5,10-11H2,1-2H3 |
| InChIKey | XUVPYWBYHUGGOB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodopropyl)pentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodopropyl)pentane-1,3-diamine?
The IUPAC name of 2-(2-iodopropyl)pentane-1,3-diamine (CID 139572582) is 2-(2-iodopropyl)pentane-1,3-diamine.
What is the SMILES notation for 2-(2-iodopropyl)pentane-1,3-diamine?
The canonical SMILES for 2-(2-iodopropyl)pentane-1,3-diamine is CCC(N)C(CN)CC(C)I.
What is the InChIKey of 2-(2-iodopropyl)pentane-1,3-diamine?
The InChIKey is XUVPYWBYHUGGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19IN2/c1-3-8(11)7(5-10)4-6(2)9/h6-8H,3-5,10-11H2,1-2H3.
What are the key properties of 2-(2-iodopropyl)pentane-1,3-diamine?
2-(2-iodopropyl)pentane-1,3-diamine has a molecular weight of 270.16 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodopropyl)pentane-1,3-diamine is sourced from PubChem (CID 139572582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).