C7H16N2OS — CID 139572965
(3R,4R)-4-amino-1-(1-sulfanylethyl)piperidin-3-ol (PubChem CID 139572965) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is (3R,4R)-4-amino-1-(1-sulfanylethyl)piperidin-3-ol.
| Compound Name | (3R,4R)-4-amino-1-(1-sulfanylethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 139572965 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3R,4R)-4-amino-1-(1-sulfanylethyl)piperidin-3-ol |
| SMILES | CC(S)N1CC[C@@H](N)[C@H](O)C1 |
| InChI | InChI=1S/C7H16N2OS/c1-5(11)9-3-2-6(8)7(10)4-9/h5-7,10-11H,2-4,8H2,1H3/t5?,6-,7-/m1/s1 |
| InChIKey | NHOBGAHQOGFBID-JXBXZBNISA-N |
| XLogP | -0.34 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|