C12H26N2O — CID 139573688
1-[[(1R,3S)-3-(tert-butylamino)cyclohexyl]amino]ethanol (PubChem CID 139573688) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-[[(1R,3S)-3-(tert-butylamino)cyclohexyl]amino]ethanol.
| Compound Name | 1-[[(1R,3S)-3-(tert-butylamino)cyclohexyl]amino]ethanol |
|---|---|
| PubChem CID | 139573688 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-[[(1R,3S)-3-(tert-butylamino)cyclohexyl]amino]ethanol |
| SMILES | CC(O)N[C@@H]1CCC[C@H](NC(C)(C)C)C1 |
| InChI | InChI=1S/C12H26N2O/c1-9(15)13-10-6-5-7-11(8-10)14-12(2,3)4/h9-11,13-15H,5-8H2,1-4H3/t9?,10-,11+/m1/s1 |
| InChIKey | MEWZAVXRXXWPQP-ZOCYIJKUSA-N |
| XLogP | 1.61 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|