C12H24N2O2 — CID 139576224
tert-butyl N-[(Z)-2-(dimethylamino)pent-2-enyl]carbamate (PubChem CID 139576224) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-(dimethylamino)pent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-(dimethylamino)pent-2-enyl]carbamate |
|---|---|
| PubChem CID | 139576224 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl N-[(Z)-2-(dimethylamino)pent-2-enyl]carbamate |
| SMILES | CC/C=C(/CNC(=O)OC(C)(C)C)N(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-7-8-10(14(5)6)9-13-11(15)16-12(2,3)4/h8H,7,9H2,1-6H3,(H,13,15)/b10-8- |
| InChIKey | XLNBHNPDMNIYBM-NTMALXAHSA-N |
| XLogP | 2.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |