C12H14BrF2NS — CID 139577228
(Z)-1-(4-bromophenyl)-N-tert-butylsulfanyl-2,2-difluoroethanimine (PubChem CID 139577228) has the molecular formula C12H14BrF2NS and a molecular weight of 322.22 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-N-tert-butylsulfanyl-2,2-difluoroethanimine.
| Compound Name | (Z)-1-(4-bromophenyl)-N-tert-butylsulfanyl-2,2-difluoroethanimine |
|---|---|
| PubChem CID | 139577228 |
| Molecular Formula | C12H14BrF2NS |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-N-tert-butylsulfanyl-2,2-difluoroethanimine |
| SMILES | CC(C)(C)S/N=C(/c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C12H14BrF2NS/c1-12(2,3)17-16-10(11(14)15)8-4-6-9(13)7-5-8/h4-7,11H,1-3H3/b16-10- |
| InChIKey | FGOBBCFAKRXIMI-YBEGLDIGSA-N |
| XLogP | 4.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|