C19H26N4O — CID 139577324
1,1-bis[(4-aminophenyl)methyl]-3-tert-butylurea (PubChem CID 139577324) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1,1-bis[(4-aminophenyl)methyl]-3-tert-butylurea.
| Compound Name | 1,1-bis[(4-aminophenyl)methyl]-3-tert-butylurea |
|---|---|
| PubChem CID | 139577324 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1,1-bis[(4-aminophenyl)methyl]-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)N(Cc1ccc(N)cc1)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-19(2,3)22-18(24)23(12-14-4-8-16(20)9-5-14)13-15-6-10-17(21)11-7-15/h4-11H,12-13,20-21H2,1-3H3,(H,22,24) |
| InChIKey | ZIEIAKNPUXFPMI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|