C18H22N6O2 — CID 139580419
8-oxa-2-azaspiro[4.5]decan-1-yl-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 139580419) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 8-oxa-2-azaspiro[4.5]decan-1-yl-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | 8-oxa-2-azaspiro[4.5]decan-1-yl-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 139580419 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 8-oxa-2-azaspiro[4.5]decan-1-yl-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cnccn2)nc1)C1NCCC12CCOCC2 |
| InChI | InChI=1S/C18H22N6O2/c25-15(16-18(1-4-21-16)2-7-26-8-3-18)13-9-22-17(23-10-13)24-12-14-11-19-5-6-20-14/h5-6,9-11,16,21H,1-4,7-8,12H2,(H,22,23,24) |
| InChIKey | GBSBQPUEIVWANW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |